About 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol
7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol (PubChem CID 58773638) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
| PubChem CID | 58773638 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
| SMILES | OCC1=CC2(C=CC1O)OCCO2 |
| InChI | InChI=1S/C9H12O4/c10-6-7-5-9(2-1-8(7)11)12-3-4-13-9/h1-2,5,8,10-11H,3-4,6H2 |
| InChIKey | OHIXGNIQUUWTPG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
The IUPAC name of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol (CID 58773638) is 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol.
What is the SMILES notation for 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
The canonical SMILES for 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol is OCC1=CC2(C=CC1O)OCCO2.
What is the InChIKey of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
The InChIKey is OHIXGNIQUUWTPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c10-6-7-5-9(2-1-8(7)11)12-3-4-13-9/h1-2,5,8,10-11H,3-4,6H2.
What are the key properties of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol?
7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol has a molecular weight of 184.19 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol is sourced from PubChem (CID 58773638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).