C18H33NO6S — CID 58773645
[3,5,7-trimethyl-8-oxo-8-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]octan-4-yl] methanesulfonate (PubChem CID 58773645) has the molecular formula C18H33NO6S and a molecular weight of 391.53 g/mol. Its IUPAC name is [3,5,7-trimethyl-8-oxo-8-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]octan-4-yl] methanesulfonate.
| Compound Name | [3,5,7-trimethyl-8-oxo-8-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]octan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 58773645 |
| Molecular Formula | C18H33NO6S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [3,5,7-trimethyl-8-oxo-8-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]octan-4-yl] methanesulfonate |
| SMILES | CCC(C)C(OS(C)(=O)=O)C(C)CC(C)C(=O)N1C(=O)OC[C@H]1C(C)C |
| InChI | InChI=1S/C18H33NO6S/c1-8-12(4)16(25-26(7,22)23)13(5)9-14(6)17(20)19-15(11(2)3)10-24-18(19)21/h11-16H,8-10H2,1-7H3/t12?,13?,14?,15-,16?/m0/s1 |
| InChIKey | PZVJOZBORBDVKZ-DQGBIZLVSA-N |
| XLogP | 3.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|