C33H14F6O10 — CID 58773760
[4-[2-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 58773760) has the molecular formula C33H14F6O10 and a molecular weight of 684.45 g/mol. Its IUPAC name is [4-[2-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[2-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 58773760 |
| Molecular Formula | C33H14F6O10 |
| Molecular Weight | 684.45 g/mol |
| Exact Mass | 684.05 |
| IUPAC Name | [4-[2-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Oc1ccc(C(c2ccc(OC(=O)c3ccc4c(c3)C(=O)OC4=O)cc2)(C(F)(F)F)C(F)(F)F)cc1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C33H14F6O10/c34-32(35,36)31(33(37,38)39,17-3-7-19(8-4-17)46-25(40)15-1-11-21-23(13-15)29(44)48-27(21)42)18-5-9-20(10-6-18)47-26(41)16-2-12-22-24(14-16)30(45)49-28(22)43/h1-14H |
| InChIKey | ZEBSVALGFCMYAA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|