methyl 2-hydroxycyclopentene-1-carboxylate

C7H10O3 — CID 58773932

IUPACmethyl 2-hydroxycyclopentene-1-carboxylate
SMILESCOC(=O)C1=C(O)CCC1
InChIInChI=1S/C7H10O3/c1-10-7(9)5-3-2-4-6(5)8/h8H,2-4H2,1H3
InChIKeyPCTQYRLRFUJDQU-UHFFFAOYSA-N
MW142.15 g/mol
LogP1.16
Rot. Bonds1

About methyl 2-hydroxycyclopentene-1-carboxylate

methyl 2-hydroxycyclopentene-1-carboxylate (PubChem CID 58773932) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is methyl 2-hydroxycyclopentene-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-hydroxycyclopentene-1-carboxylate
PubChem CID58773932
Molecular FormulaC7H10O3
Molecular Weight142.15 g/mol
Exact Mass142.06
IUPAC Namemethyl 2-hydroxycyclopentene-1-carboxylate
SMILESCOC(=O)C1=C(O)CCC1
InChIInChI=1S/C7H10O3/c1-10-7(9)5-3-2-4-6(5)8/h8H,2-4H2,1H3
InChIKeyPCTQYRLRFUJDQU-UHFFFAOYSA-N
XLogP1.16
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.15
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-hydroxycyclopentene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-hydroxycyclopentene-1-carboxylate?
The IUPAC name of methyl 2-hydroxycyclopentene-1-carboxylate (CID 58773932) is methyl 2-hydroxycyclopentene-1-carboxylate.
What is the SMILES notation for methyl 2-hydroxycyclopentene-1-carboxylate?
The canonical SMILES for methyl 2-hydroxycyclopentene-1-carboxylate is COC(=O)C1=C(O)CCC1.
What is the InChIKey of methyl 2-hydroxycyclopentene-1-carboxylate?
The InChIKey is PCTQYRLRFUJDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-10-7(9)5-3-2-4-6(5)8/h8H,2-4H2,1H3.
What are the key properties of methyl 2-hydroxycyclopentene-1-carboxylate?
methyl 2-hydroxycyclopentene-1-carboxylate has a molecular weight of 142.15 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxycyclopentene-1-carboxylate is sourced from PubChem (CID 58773932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).