C41H38FN3O6P2 — CID 58774079
[fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 58774079) has the molecular formula C41H38FN3O6P2 and a molecular weight of 749.72 g/mol. Its IUPAC name is [fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | [fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 58774079 |
| Molecular Formula | C41H38FN3O6P2 |
| Molecular Weight | 749.72 g/mol |
| Exact Mass | 749.22 |
| IUPAC Name | [fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]anilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COc1ccc(C(OCN(CC(=O)N2CCc3c2ccc2[nH]c(C(=O)OP(F)P)cc32)c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H38FN3O6P2/c1-48-32-17-13-29(14-18-32)41(28-9-5-3-6-10-28,30-15-19-33(49-2)20-16-30)50-27-44(31-11-7-4-8-12-31)26-39(46)45-24-23-34-35-25-37(40(47)51-53(42)52)43-36(35)21-22-38(34)45/h3-22,25,43H,23-24,26-27,52H2,1-2H3 |
| InChIKey | FUNQLKVFPBBXMN-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.72 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|