C20H36O7Si — CID 58774273
[(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propyl]-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate (PubChem CID 58774273) has the molecular formula C20H36O7Si and a molecular weight of 416.59 g/mol. Its IUPAC name is [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propyl]-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate.
| Compound Name | [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propyl]-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
|---|---|
| PubChem CID | 58774273 |
| Molecular Formula | C20H36O7Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(methoxymethoxy)propyl]-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
| SMILES | COCOCCCC1[C@H]2C[C@@](OC(C)=O)(C[C@H]1O[Si](C)(C)C(C)(C)C)C(=O)O2 |
| InChI | InChI=1S/C20H36O7Si/c1-14(21)26-20-11-16(25-18(20)22)15(9-8-10-24-13-23-5)17(12-20)27-28(6,7)19(2,3)4/h15-17H,8-13H2,1-7H3/t15?,16-,17-,20-/m1/s1 |
| InChIKey | QERKPNANLMBLAA-RXKHTKJTSA-N |
| XLogP | 3.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|