About 6,7-dihydropurin-6-id-2-amine;tungsten
6,7-dihydropurin-6-id-2-amine;tungsten (PubChem CID 58774725) has the molecular formula C5H4N5W-
and a molecular weight of 317.96 g/mol. Its IUPAC name is 6,7-dihydropurin-6-id-2-amine;tungsten.
Molecular Properties
| Compound Name | 6,7-dihydropurin-6-id-2-amine;tungsten |
| PubChem CID | 58774725 |
| Molecular Formula | C5H4N5W- |
| Molecular Weight | 317.96 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 6,7-dihydropurin-6-id-2-amine;tungsten |
| SMILES | Nc1n[c-]c2[nH]cnc2n1.[W] |
| InChI | InChI=1S/C5H4N5.W/c6-5-7-1-3-4(10-5)9-2-8-3;/h2H,(H3,6,7,8,9,10);/q-1; |
| InChIKey | LUJORFDIPWOGDF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.96 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydropurin-6-id-2-amine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydropurin-6-id-2-amine;tungsten?
The IUPAC name of 6,7-dihydropurin-6-id-2-amine;tungsten (CID 58774725) is 6,7-dihydropurin-6-id-2-amine;tungsten.
What is the SMILES notation for 6,7-dihydropurin-6-id-2-amine;tungsten?
The canonical SMILES for 6,7-dihydropurin-6-id-2-amine;tungsten is Nc1n[c-]c2[nH]cnc2n1.[W].
What is the InChIKey of 6,7-dihydropurin-6-id-2-amine;tungsten?
The InChIKey is LUJORFDIPWOGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N5.W/c6-5-7-1-3-4(10-5)9-2-8-3;/h2H,(H3,6,7,8,9,10);/q-1;.
What are the key properties of 6,7-dihydropurin-6-id-2-amine;tungsten?
6,7-dihydropurin-6-id-2-amine;tungsten has a molecular weight of 317.96 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydropurin-6-id-2-amine;tungsten is sourced from PubChem (CID 58774725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).