About 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide
2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide (PubChem CID 58775487) has the molecular formula C20H22N4OS
and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide |
| PubChem CID | 58775487 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide |
| SMILES | CCc1nc(-c2ccsc2)nc(Nc2ccc(CC(N)=O)cc2)c1CC |
| InChI | InChI=1S/C20H22N4OS/c1-3-16-17(4-2)23-19(14-9-10-26-12-14)24-20(16)22-15-7-5-13(6-8-15)11-18(21)25/h5-10,12H,3-4,11H2,1-2H3,(H2,21,25)(H,22,23,24) |
| InChIKey | JVPQWBALYIKHJA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide?
The IUPAC name of 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide (CID 58775487) is 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide.
What is the SMILES notation for 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide?
The canonical SMILES for 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide is CCc1nc(-c2ccsc2)nc(Nc2ccc(CC(N)=O)cc2)c1CC.
What is the InChIKey of 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide?
The InChIKey is JVPQWBALYIKHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4OS/c1-3-16-17(4-2)23-19(14-9-10-26-12-14)24-20(16)22-15-7-5-13(6-8-15)11-18(21)25/h5-10,12H,3-4,11H2,1-2H3,(H2,21,25)(H,22,23,24).
What are the key properties of 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide?
2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide has a molecular weight of 366.49 g/mol, XLogP of 4.10, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(5,6-diethyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetamide is sourced from PubChem (CID 58775487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).