About 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride
3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride (PubChem CID 58775734) has the molecular formula C11H10ClN3O2
and a molecular weight of 251.67 g/mol. Its IUPAC name is 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride.
Molecular Properties
| Compound Name | 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride |
| PubChem CID | 58775734 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride |
| SMILES | O=C(Cl)CCc1ncn(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C11H10ClN3O2/c12-10(17)5-6-11-13-7-15(14-11)8-1-3-9(16)4-2-8/h1-4,7,16H,5-6H2 |
| InChIKey | KWYRSSINXBWXBS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride?
The IUPAC name of 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride (CID 58775734) is 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride.
What is the SMILES notation for 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride?
The canonical SMILES for 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride is O=C(Cl)CCc1ncn(-c2ccc(O)cc2)n1.
What is the InChIKey of 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride?
The InChIKey is KWYRSSINXBWXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O2/c12-10(17)5-6-11-13-7-15(14-11)8-1-3-9(16)4-2-8/h1-4,7,16H,5-6H2.
What are the key properties of 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride?
3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride has a molecular weight of 251.67 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]propanoyl chloride is sourced from PubChem (CID 58775734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).