About CID 58775858
CID 58775858 (PubChem CID 58775858) has the molecular formula C11H18O4Si
and a molecular weight of 242.35 g/mol.
Molecular Properties
| Compound Name | CID 58775858 |
| PubChem CID | 58775858 |
| Molecular Formula | C11H18O4Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | — |
| SMILES | C=C(/C=C(\OC)C(=O)OC)O[Si]C(C)(C)C |
| InChI | InChI=1S/C11H18O4Si/c1-8(15-16-11(2,3)4)7-9(13-5)10(12)14-6/h7H,1H2,2-6H3/b9-7- |
| InChIKey | OIJPUIHJKMGAPB-CLFYSBASSA-N |
| XLogP | 2.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 58775858 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58775858?
The IUPAC name of CID 58775858 (CID 58775858) is not available.
What is the SMILES notation for CID 58775858?
The canonical SMILES for CID 58775858 is C=C(/C=C(\OC)C(=O)OC)O[Si]C(C)(C)C.
What is the InChIKey of CID 58775858?
The InChIKey is OIJPUIHJKMGAPB-CLFYSBASSA-N. The full InChI is InChI=1S/C11H18O4Si/c1-8(15-16-11(2,3)4)7-9(13-5)10(12)14-6/h7H,1H2,2-6H3/b9-7-.
What are the key properties of CID 58775858?
CID 58775858 has a molecular weight of 242.35 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58775858 is sourced from PubChem (CID 58775858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).