C13H14N3O4Y- — CID 58775864
2-methyl-8-(oxomethyl)spiro[8H-[1,2,4]triazolo[1,2-a]pyridazine-5,4'-cyclohexane]-1,1',3-trione;yttrium (PubChem CID 58775864) has the molecular formula C13H14N3O4Y- and a molecular weight of 365.18 g/mol. Its IUPAC name is 2-methyl-8-(oxomethyl)spiro[8H-[1,2,4]triazolo[1,2-a]pyridazine-5,4'-cyclohexane]-1,1',3-trione;yttrium.
| Compound Name | 2-methyl-8-(oxomethyl)spiro[8H-[1,2,4]triazolo[1,2-a]pyridazine-5,4'-cyclohexane]-1,1',3-trione;yttrium |
|---|---|
| PubChem CID | 58775864 |
| Molecular Formula | C13H14N3O4Y- |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-methyl-8-(oxomethyl)spiro[8H-[1,2,4]triazolo[1,2-a]pyridazine-5,4'-cyclohexane]-1,1',3-trione;yttrium |
| SMILES | Cn1c(=O)n2n(c1=O)C1(C=CC2[C-]=O)CCC(=O)CC1.[Y] |
| InChI | InChI=1S/C13H14N3O4.Y/c1-14-11(19)15-9(8-17)2-5-13(16(15)12(14)20)6-3-10(18)4-7-13;/h2,5,9H,3-4,6-7H2,1H3;/q-1; |
| InChIKey | PRRIJBQRYKVKAV-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|