C3H10O9P4 — CID 58776001
(2,6-dihydroxy-2,4,6-trioxo-1,2λ5,4λ5,6λ5-oxatriphosphinan-4-yl)methylphosphonic acid (PubChem CID 58776001) has the molecular formula C3H10O9P4 and a molecular weight of 314.00 g/mol. Its IUPAC name is (2,6-dihydroxy-2,4,6-trioxo-1,2λ5,4λ5,6λ5-oxatriphosphinan-4-yl)methylphosphonic acid.
| Compound Name | (2,6-dihydroxy-2,4,6-trioxo-1,2λ5,4λ5,6λ5-oxatriphosphinan-4-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 58776001 |
| Molecular Formula | C3H10O9P4 |
| Molecular Weight | 314.00 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | (2,6-dihydroxy-2,4,6-trioxo-1,2λ5,4λ5,6λ5-oxatriphosphinan-4-yl)methylphosphonic acid |
| SMILES | O=P(O)(O)CP1(=O)CP(=O)(O)OP(=O)(O)C1 |
| InChI | InChI=1S/C3H10O9P4/c4-13(1-14(5,6)7)2-15(8,9)12-16(10,11)3-13/h1-3H2,(H,8,9)(H,10,11)(H2,5,6,7) |
| InChIKey | ZTJSUSPTWYFMSI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.00 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|