C46H42F4O14 — CID 58776237
[2,2-difluoro-7-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]oxy-1,3-benzodioxol-4-yl] 2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxole-4-carboxylate (PubChem CID 58776237) has the molecular formula C46H42F4O14 and a molecular weight of 894.82 g/mol. Its IUPAC name is [2,2-difluoro-7-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]oxy-1,3-benzodioxol-4-yl] 2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxole-4-carboxylate.
| Compound Name | [2,2-difluoro-7-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]oxy-1,3-benzodioxol-4-yl] 2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 58776237 |
| Molecular Formula | C46H42F4O14 |
| Molecular Weight | 894.82 g/mol |
| Exact Mass | 894.25 |
| IUPAC Name | [2,2-difluoro-7-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]benzoyl]oxy-1,3-benzodioxol-4-yl] 2,2-difluoro-7-(6-prop-2-enoyloxyhexoxy)-1,3-benzodioxole-4-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(OCCCCCCOC(=O)C=C)c5c4OC(F)(F)O5)c4c3OC(F)(F)O4)cc2)cc1 |
| InChI | InChI=1S/C46H42F4O14/c1-3-37(51)57-27-11-7-5-9-25-55-32-19-17-30(18-20-32)29-13-15-31(16-14-29)43(53)59-35-23-24-36(42-41(35)63-46(49,50)64-42)60-44(54)33-21-22-34(40-39(33)61-45(47,48)62-40)56-26-10-6-8-12-28-58-38(52)4-2/h3-4,13-24H,1-2,5-12,25-28H2 |
| InChIKey | NUERPPNDBVXMLT-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.82 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|