C42H34F4O14 — CID 58776265
[4-[[7-[2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxol-4-yl]-2,2-difluoro-1,3-benzodioxol-4-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 58776265) has the molecular formula C42H34F4O14 and a molecular weight of 838.71 g/mol. Its IUPAC name is [4-[[7-[2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxol-4-yl]-2,2-difluoro-1,3-benzodioxol-4-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[[7-[2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxol-4-yl]-2,2-difluoro-1,3-benzodioxol-4-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 58776265 |
| Molecular Formula | C42H34F4O14 |
| Molecular Weight | 838.71 g/mol |
| Exact Mass | 838.19 |
| IUPAC Name | [4-[[7-[2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxol-4-yl]-2,2-difluoro-1,3-benzodioxol-4-yl]oxycarbonyl]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(-c4ccc(OCCCCOC(=O)C=C)c5c4OC(F)(F)O5)c4c3OC(F)(F)O4)cc2)cc1 |
| InChI | InChI=1S/C42H34F4O14/c1-3-33(47)53-23-7-5-21-51-27-13-9-25(10-14-27)39(49)55-28-15-11-26(12-16-28)40(50)56-32-20-18-30(36-38(32)60-42(45,46)58-36)29-17-19-31(37-35(29)57-41(43,44)59-37)52-22-6-8-24-54-34(48)4-2/h3-4,9-20H,1-2,5-8,21-24H2 |
| InChIKey | GIQCEGOJWOCATG-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.71 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|