C33H38F6O5 — CID 58776354
[4-[5-[4-[4-(2-oxobut-3-enyl)cyclohexyl]-1-bicyclo[2.2.2]octanyl]-1,3-dioxan-2-yl]-2,3-bis(trifluoromethyl)phenyl] prop-2-enoate (PubChem CID 58776354) has the molecular formula C33H38F6O5 and a molecular weight of 628.65 g/mol. Its IUPAC name is [4-[5-[4-[4-(2-oxobut-3-enyl)cyclohexyl]-1-bicyclo[2.2.2]octanyl]-1,3-dioxan-2-yl]-2,3-bis(trifluoromethyl)phenyl] prop-2-enoate.
| Compound Name | [4-[5-[4-[4-(2-oxobut-3-enyl)cyclohexyl]-1-bicyclo[2.2.2]octanyl]-1,3-dioxan-2-yl]-2,3-bis(trifluoromethyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 58776354 |
| Molecular Formula | C33H38F6O5 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | [4-[5-[4-[4-(2-oxobut-3-enyl)cyclohexyl]-1-bicyclo[2.2.2]octanyl]-1,3-dioxan-2-yl]-2,3-bis(trifluoromethyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)CC1CCC(C23CCC(C4COC(c5ccc(OC(=O)C=C)c(C(F)(F)F)c5C(F)(F)F)OC4)(CC2)CC3)CC1 |
| InChI | InChI=1S/C33H38F6O5/c1-3-23(40)17-20-5-7-21(8-6-20)30-11-14-31(15-12-30,16-13-30)22-18-42-29(43-19-22)24-9-10-25(44-26(41)4-2)28(33(37,38)39)27(24)32(34,35)36/h3-4,9-10,20-22,29H,1-2,5-8,11-19H2 |
| InChIKey | YWWQAGWVXYQGJY-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|