C33H39BO4 — CID 58776555
[2-acetyloxy-3,7-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborol-8-yl] acetate (PubChem CID 58776555) has the molecular formula C33H39BO4 and a molecular weight of 510.48 g/mol. Its IUPAC name is [2-acetyloxy-3,7-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborol-8-yl] acetate.
| Compound Name | [2-acetyloxy-3,7-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborol-8-yl] acetate |
|---|---|
| PubChem CID | 58776555 |
| Molecular Formula | C33H39BO4 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | [2-acetyloxy-3,7-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborol-8-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C)B(c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1cc(C)c(OC(C)=O)cc1-2 |
| InChI | InChI=1S/C33H39BO4/c1-17(2)24-13-25(18(3)4)33(26(14-24)19(5)6)34-29-11-20(7)31(37-22(9)35)15-27(29)28-16-32(38-23(10)36)21(8)12-30(28)34/h11-19H,1-10H3 |
| InChIKey | POAJFYZZIFDPFF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|