C21H27F9O2 — CID 58776708
4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5,5-trifluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 58776708) has the molecular formula C21H27F9O2 and a molecular weight of 482.43 g/mol. Its IUPAC name is 4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5,5-trifluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5,5-trifluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 58776708 |
| Molecular Formula | C21H27F9O2 |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5,5-trifluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CCOCOC(CC1(F)C2CC(C3C4CC(C(C)C4C)C32)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H27F9O2/c1-4-31-8-32-18(20(25,26)27,21(28,29)30)7-17(22)13-6-14(19(17,23)24)16-12-5-11(15(13)16)9(2)10(12)3/h9-16H,4-8H2,1-3H3 |
| InChIKey | XKQVSBOEEQPIDZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|