C26H31F15O4 — CID 58776748
2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58776748) has the molecular formula C26H31F15O4 and a molecular weight of 692.50 g/mol. Its IUPAC name is 2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58776748 |
| Molecular Formula | C26H31F15O4 |
| Molecular Weight | 692.50 g/mol |
| Exact Mass | 692.20 |
| IUPAC Name | 2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C1C)C(C(=O)OC(C)(C)C1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1)(C(F)(F)F)C2 |
| InChI | InChI=1S/C26H31F15O4/c1-10-11(2)16-5-12(10)9-19(16,22(27,28)29)17(42)45-18(3,4)13-6-14(20(43,23(30,31)32)24(33,34)35)8-15(7-13)21(44,25(36,37)38)26(39,40)41/h10-16,43-44H,5-9H2,1-4H3 |
| InChIKey | IBEASAYLZFCILA-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.50 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |