About (1-propylcyclohexyl) 2,2-dimethylbutanoate
(1-propylcyclohexyl) 2,2-dimethylbutanoate (PubChem CID 58776781) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is (1-propylcyclohexyl) 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (1-propylcyclohexyl) 2,2-dimethylbutanoate |
| PubChem CID | 58776781 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (1-propylcyclohexyl) 2,2-dimethylbutanoate |
| SMILES | CCCC1(OC(=O)C(C)(C)CC)CCCCC1 |
| InChI | InChI=1S/C15H28O2/c1-5-10-15(11-8-7-9-12-15)17-13(16)14(3,4)6-2/h5-12H2,1-4H3 |
| InChIKey | DIPJOJYHFKTJFJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-propylcyclohexyl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylcyclohexyl) 2,2-dimethylbutanoate?
The IUPAC name of (1-propylcyclohexyl) 2,2-dimethylbutanoate (CID 58776781) is (1-propylcyclohexyl) 2,2-dimethylbutanoate.
What is the SMILES notation for (1-propylcyclohexyl) 2,2-dimethylbutanoate?
The canonical SMILES for (1-propylcyclohexyl) 2,2-dimethylbutanoate is CCCC1(OC(=O)C(C)(C)CC)CCCCC1.
What is the InChIKey of (1-propylcyclohexyl) 2,2-dimethylbutanoate?
The InChIKey is DIPJOJYHFKTJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-5-10-15(11-8-7-9-12-15)17-13(16)14(3,4)6-2/h5-12H2,1-4H3.
What are the key properties of (1-propylcyclohexyl) 2,2-dimethylbutanoate?
(1-propylcyclohexyl) 2,2-dimethylbutanoate has a molecular weight of 240.39 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylcyclohexyl) 2,2-dimethylbutanoate is sourced from PubChem (CID 58776781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).