About 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium
1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium (PubChem CID 58777372) has the molecular formula C7H7N2O4PY-2
and a molecular weight of 303.02 g/mol. Its IUPAC name is 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium.
Molecular Properties
| Compound Name | 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium |
| PubChem CID | 58777372 |
| Molecular Formula | C7H7N2O4PY-2 |
| Molecular Weight | 303.02 g/mol |
| Exact Mass | 302.92 |
| IUPAC Name | 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium |
| SMILES | [CH2-]c1nc(C(=O)O)c(OP)c(=O)n1[CH2-].[Y] |
| InChI | InChI=1S/C7H7N2O4P.Y/c1-3-8-4(7(11)12)5(13-14)6(10)9(3)2;/h1-2,14H2,(H,11,12);/q-2; |
| InChIKey | TVZAFSQHPMEHRM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.02 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium?
The IUPAC name of 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium (CID 58777372) is 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium.
What is the SMILES notation for 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium?
The canonical SMILES for 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium is [CH2-]c1nc(C(=O)O)c(OP)c(=O)n1[CH2-].[Y].
What is the InChIKey of 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium?
The InChIKey is TVZAFSQHPMEHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O4P.Y/c1-3-8-4(7(11)12)5(13-14)6(10)9(3)2;/h1-2,14H2,(H,11,12);/q-2;.
What are the key properties of 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium?
1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium has a molecular weight of 303.02 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethanidyl-6-oxo-5-phosphanyloxypyrimidine-4-carboxylic acid;yttrium is sourced from PubChem (CID 58777372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).