C25H20F3N3O3S — CID 58777471
2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one (PubChem CID 58777471) has the molecular formula C25H20F3N3O3S and a molecular weight of 499.51 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one.
| Compound Name | 2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one |
|---|---|
| PubChem CID | 58777471 |
| Molecular Formula | C25H20F3N3O3S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CCN(c4ccc(C(F)(F)F)cc4)CC3)c3c2c2c(cccc12)C3 |
| InChI | InChI=1S/C25H20F3N3O3S/c26-25(27,28)16-4-6-17(7-5-16)30-10-12-31(13-11-30)35(33,34)21-9-8-20-23-19(21)14-15-2-1-3-18(22(15)23)24(32)29-20/h1-9H,10-14H2,(H,29,32) |
| InChIKey | HPZHQYHZHZKMEG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|