C20H23N3O3S — CID 58777474
N-[3-(dimethylamino)propyl]-N-methyl-7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaene-2-sulfonamide (PubChem CID 58777474) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-methyl-7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaene-2-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-methyl-7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaene-2-sulfonamide |
|---|---|
| PubChem CID | 58777474 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-methyl-7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaene-2-sulfonamide |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1ccc2[nH]c(=O)c3cccc4c3c2c1C4 |
| InChI | InChI=1S/C20H23N3O3S/c1-22(2)10-5-11-23(3)27(25,26)17-9-8-16-19-15(17)12-13-6-4-7-14(18(13)19)20(24)21-16/h4,6-9H,5,10-12H2,1-3H3,(H,21,24) |
| InChIKey | KIMCUVSMMGQURV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|