C8H10F3N3 — CID 58778094
7-methanidyl-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-7-ium (PubChem CID 58778094) has the molecular formula C8H10F3N3 and a molecular weight of 205.18 g/mol. Its IUPAC name is 7-methanidyl-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-7-ium.
| Compound Name | 7-methanidyl-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-7-ium |
|---|---|
| PubChem CID | 58778094 |
| Molecular Formula | C8H10F3N3 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 7-methanidyl-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-7-ium |
| SMILES | [CH2-][NH+]1CCn2cc(C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C8H10F3N3/c1-13-2-3-14-4-6(8(9,10)11)12-7(14)5-13/h4,13H,1-3,5H2 |
| InChIKey | XQCMFQDSGJVJJO-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 22.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|