About 3,4-ditert-butyl-2,3-dihydrofuran
3,4-ditert-butyl-2,3-dihydrofuran (PubChem CID 58778250) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 3,4-ditert-butyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-2,3-dihydrofuran |
| PubChem CID | 58778250 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 3,4-ditert-butyl-2,3-dihydrofuran |
| SMILES | CC(C)(C)C1=COCC1C(C)(C)C |
| InChI | InChI=1S/C12H22O/c1-11(2,3)9-7-13-8-10(9)12(4,5)6/h7,10H,8H2,1-6H3 |
| InChIKey | WELKTIJZGRAWPN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-ditert-butyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-2,3-dihydrofuran?
The IUPAC name of 3,4-ditert-butyl-2,3-dihydrofuran (CID 58778250) is 3,4-ditert-butyl-2,3-dihydrofuran.
What is the SMILES notation for 3,4-ditert-butyl-2,3-dihydrofuran?
The canonical SMILES for 3,4-ditert-butyl-2,3-dihydrofuran is CC(C)(C)C1=COCC1C(C)(C)C.
What is the InChIKey of 3,4-ditert-butyl-2,3-dihydrofuran?
The InChIKey is WELKTIJZGRAWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-11(2,3)9-7-13-8-10(9)12(4,5)6/h7,10H,8H2,1-6H3.
What are the key properties of 3,4-ditert-butyl-2,3-dihydrofuran?
3,4-ditert-butyl-2,3-dihydrofuran has a molecular weight of 182.31 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-2,3-dihydrofuran is sourced from PubChem (CID 58778250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).