About 3,4-ditert-butyl-2,5-dihydrothiophene
3,4-ditert-butyl-2,5-dihydrothiophene (PubChem CID 58778260) has the molecular formula C12H22S
and a molecular weight of 198.37 g/mol. Its IUPAC name is 3,4-ditert-butyl-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-2,5-dihydrothiophene |
| PubChem CID | 58778260 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3,4-ditert-butyl-2,5-dihydrothiophene |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)CSC1 |
| InChI | InChI=1S/C12H22S/c1-11(2,3)9-7-13-8-10(9)12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | KJIOVOVLIDZIPA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-ditert-butyl-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-2,5-dihydrothiophene?
The IUPAC name of 3,4-ditert-butyl-2,5-dihydrothiophene (CID 58778260) is 3,4-ditert-butyl-2,5-dihydrothiophene.
What is the SMILES notation for 3,4-ditert-butyl-2,5-dihydrothiophene?
The canonical SMILES for 3,4-ditert-butyl-2,5-dihydrothiophene is CC(C)(C)C1=C(C(C)(C)C)CSC1.
What is the InChIKey of 3,4-ditert-butyl-2,5-dihydrothiophene?
The InChIKey is KJIOVOVLIDZIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22S/c1-11(2,3)9-7-13-8-10(9)12(4,5)6/h7-8H2,1-6H3.
What are the key properties of 3,4-ditert-butyl-2,5-dihydrothiophene?
3,4-ditert-butyl-2,5-dihydrothiophene has a molecular weight of 198.37 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-2,5-dihydrothiophene is sourced from PubChem (CID 58778260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).