About 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran
4,5-ditert-butyl-3,6-dihydro-2H-thiopyran (PubChem CID 58778261) has the molecular formula C13H24S
and a molecular weight of 212.40 g/mol. Its IUPAC name is 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran |
| PubChem CID | 58778261 |
| Molecular Formula | C13H24S |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)CSCC1 |
| InChI | InChI=1S/C13H24S/c1-12(2,3)10-7-8-14-9-11(10)13(4,5)6/h7-9H2,1-6H3 |
| InChIKey | UZKSTBPVRSORLW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran?
The IUPAC name of 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran (CID 58778261) is 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran.
What is the SMILES notation for 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran?
The canonical SMILES for 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran is CC(C)(C)C1=C(C(C)(C)C)CSCC1.
What is the InChIKey of 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran?
The InChIKey is UZKSTBPVRSORLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24S/c1-12(2,3)10-7-8-14-9-11(10)13(4,5)6/h7-9H2,1-6H3.
What are the key properties of 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran?
4,5-ditert-butyl-3,6-dihydro-2H-thiopyran has a molecular weight of 212.40 g/mol, XLogP of 4.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-3,6-dihydro-2H-thiopyran is sourced from PubChem (CID 58778261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).