About 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine
2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine (PubChem CID 58778398) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine.
Molecular Properties
| Compound Name | 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine |
| PubChem CID | 58778398 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine |
| SMILES | CCOCC1CCC(C(C)C)CN1C(C)C |
| InChI | InChI=1S/C14H29NO/c1-6-16-10-14-8-7-13(11(2)3)9-15(14)12(4)5/h11-14H,6-10H2,1-5H3 |
| InChIKey | PIWIPXUNPGOQDU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine?
The IUPAC name of 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine (CID 58778398) is 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine.
What is the SMILES notation for 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine?
The canonical SMILES for 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine is CCOCC1CCC(C(C)C)CN1C(C)C.
What is the InChIKey of 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine?
The InChIKey is PIWIPXUNPGOQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-6-16-10-14-8-7-13(11(2)3)9-15(14)12(4)5/h11-14H,6-10H2,1-5H3.
What are the key properties of 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine?
2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine has a molecular weight of 227.39 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxymethyl)-1,5-di(propan-2-yl)piperidine is sourced from PubChem (CID 58778398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).