About methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate
methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate (PubChem CID 58778456) has the molecular formula C17H30N2O5
and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate |
| PubChem CID | 58778456 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OC[C@@H]2C[C@H](OCC(=O)N(C)C)CN2)CC1 |
| InChI | InChI=1S/C17H30N2O5/c1-19(2)16(20)11-24-15-8-13(18-9-15)10-23-14-6-4-12(5-7-14)17(21)22-3/h12-15,18H,4-11H2,1-3H3/t12?,13-,14?,15-/m0/s1 |
| InChIKey | NOURHGXUFJXQBU-SHWKFHJASA-N |
| XLogP | 0.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate (CID 58778456) is methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate is COC(=O)C1CCC(OC[C@@H]2C[C@H](OCC(=O)N(C)C)CN2)CC1.
What is the InChIKey of methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
The InChIKey is NOURHGXUFJXQBU-SHWKFHJASA-N. The full InChI is InChI=1S/C17H30N2O5/c1-19(2)16(20)11-24-15-8-13(18-9-15)10-23-14-6-4-12(5-7-14)17(21)22-3/h12-15,18H,4-11H2,1-3H3/t12?,13-,14?,15-/m0/s1.
What are the key properties of methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate has a molecular weight of 342.44 g/mol, XLogP of 0.57, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(2S,4S)-4-[2-(dimethylamino)-2-oxoethoxy]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate is sourced from PubChem (CID 58778456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).