About 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine
4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine (PubChem CID 58778463) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine |
| PubChem CID | 58778463 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine |
| SMILES | CSC1CC(C(C)C)N(C(C)C)C1 |
| InChI | InChI=1S/C11H23NS/c1-8(2)11-6-10(13-5)7-12(11)9(3)4/h8-11H,6-7H2,1-5H3 |
| InChIKey | MHPMXXKASMMMAY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine?
The IUPAC name of 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine (CID 58778463) is 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine.
What is the SMILES notation for 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine?
The canonical SMILES for 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine is CSC1CC(C(C)C)N(C(C)C)C1.
What is the InChIKey of 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine?
The InChIKey is MHPMXXKASMMMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS/c1-8(2)11-6-10(13-5)7-12(11)9(3)4/h8-11H,6-7H2,1-5H3.
What are the key properties of 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine?
4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine has a molecular weight of 201.38 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-1,2-di(propan-2-yl)pyrrolidine is sourced from PubChem (CID 58778463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).