About 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine
3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine (PubChem CID 58778510) has the molecular formula C11H22FN
and a molecular weight of 187.30 g/mol. Its IUPAC name is 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine |
| PubChem CID | 58778510 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine |
| SMILES | CC(C)C1CN(C(C)C)CC1CF |
| InChI | InChI=1S/C11H22FN/c1-8(2)11-7-13(9(3)4)6-10(11)5-12/h8-11H,5-7H2,1-4H3 |
| InChIKey | SETYJWJPINOPSA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine?
The IUPAC name of 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine (CID 58778510) is 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine.
What is the SMILES notation for 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine?
The canonical SMILES for 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine is CC(C)C1CN(C(C)C)CC1CF.
What is the InChIKey of 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine?
The InChIKey is SETYJWJPINOPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22FN/c1-8(2)11-7-13(9(3)4)6-10(11)5-12/h8-11H,5-7H2,1-4H3.
What are the key properties of 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine?
3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine has a molecular weight of 187.30 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)-1,4-di(propan-2-yl)pyrrolidine is sourced from PubChem (CID 58778510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).