About methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate
methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate (PubChem CID 58778556) has the molecular formula C14H25NO4
and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate |
| PubChem CID | 58778556 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OC[C@H]2NCC[C@@H]2OC)CC1 |
| InChI | InChI=1S/C14H25NO4/c1-17-13-7-8-15-12(13)9-19-11-5-3-10(4-6-11)14(16)18-2/h10-13,15H,3-9H2,1-2H3/t10?,11?,12-,13+/m1/s1 |
| InChIKey | NUQBSTPVOBTSPJ-TUUUFIMRSA-N |
| XLogP | 1.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate (CID 58778556) is methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate is COC(=O)C1CCC(OC[C@H]2NCC[C@@H]2OC)CC1.
What is the InChIKey of methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
The InChIKey is NUQBSTPVOBTSPJ-TUUUFIMRSA-N. The full InChI is InChI=1S/C14H25NO4/c1-17-13-7-8-15-12(13)9-19-11-5-3-10(4-6-11)14(16)18-2/h10-13,15H,3-9H2,1-2H3/t10?,11?,12-,13+/m1/s1.
What are the key properties of methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate?
methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate has a molecular weight of 271.36 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(2R,3S)-3-methoxypyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylate is sourced from PubChem (CID 58778556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).