About 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole
2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole (PubChem CID 58778682) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole |
| PubChem CID | 58778682 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole |
| SMILES | COCC1C=CC(C(C)C)N1C(C)C |
| InChI | InChI=1S/C12H23NO/c1-9(2)12-7-6-11(8-14-5)13(12)10(3)4/h6-7,9-12H,8H2,1-5H3 |
| InChIKey | WAPLKZIVEQRPAB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole?
The IUPAC name of 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole (CID 58778682) is 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole.
What is the SMILES notation for 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole?
The canonical SMILES for 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole is COCC1C=CC(C(C)C)N1C(C)C.
What is the InChIKey of 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole?
The InChIKey is WAPLKZIVEQRPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-9(2)12-7-6-11(8-14-5)13(12)10(3)4/h6-7,9-12H,8H2,1-5H3.
What are the key properties of 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole?
2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole has a molecular weight of 197.32 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-1,5-di(propan-2-yl)-2,5-dihydropyrrole is sourced from PubChem (CID 58778682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).