About 1,2-di(propan-2-yl)-2,5-dihydropyrrole
1,2-di(propan-2-yl)-2,5-dihydropyrrole (PubChem CID 58778697) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)-2,5-dihydropyrrole |
| PubChem CID | 58778697 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 1,2-di(propan-2-yl)-2,5-dihydropyrrole |
| SMILES | CC(C)C1C=CCN1C(C)C |
| InChI | InChI=1S/C10H19N/c1-8(2)10-6-5-7-11(10)9(3)4/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | BVZNKBUVVIDOQY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-di(propan-2-yl)-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)-2,5-dihydropyrrole?
The IUPAC name of 1,2-di(propan-2-yl)-2,5-dihydropyrrole (CID 58778697) is 1,2-di(propan-2-yl)-2,5-dihydropyrrole.
What is the SMILES notation for 1,2-di(propan-2-yl)-2,5-dihydropyrrole?
The canonical SMILES for 1,2-di(propan-2-yl)-2,5-dihydropyrrole is CC(C)C1C=CCN1C(C)C.
What is the InChIKey of 1,2-di(propan-2-yl)-2,5-dihydropyrrole?
The InChIKey is BVZNKBUVVIDOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-8(2)10-6-5-7-11(10)9(3)4/h5-6,8-10H,7H2,1-4H3.
What are the key properties of 1,2-di(propan-2-yl)-2,5-dihydropyrrole?
1,2-di(propan-2-yl)-2,5-dihydropyrrole has a molecular weight of 153.27 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)-2,5-dihydropyrrole is sourced from PubChem (CID 58778697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).