About 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol
3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol (PubChem CID 58778737) has the molecular formula C9H18FNO2
and a molecular weight of 191.25 g/mol. Its IUPAC name is 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol |
| PubChem CID | 58778737 |
| Molecular Formula | C9H18FNO2 |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol |
| SMILES | CN1C[C@@H](F)C[C@H]1COCCCO |
| InChI | InChI=1S/C9H18FNO2/c1-11-6-8(10)5-9(11)7-13-4-2-3-12/h8-9,12H,2-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | MPKYVCWOTMBTHT-IUCAKERBSA-N |
| XLogP | 0.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol?
The IUPAC name of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol (CID 58778737) is 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol.
What is the SMILES notation for 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol?
The canonical SMILES for 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol is CN1C[C@@H](F)C[C@H]1COCCCO.
What is the InChIKey of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol?
The InChIKey is MPKYVCWOTMBTHT-IUCAKERBSA-N. The full InChI is InChI=1S/C9H18FNO2/c1-11-6-8(10)5-9(11)7-13-4-2-3-12/h8-9,12H,2-7H2,1H3/t8-,9-/m0/s1.
What are the key properties of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol?
3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol has a molecular weight of 191.25 g/mol, XLogP of 0.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]propan-1-ol is sourced from PubChem (CID 58778737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).