About 4-methoxy-1,3-di(propan-2-yl)piperidine
4-methoxy-1,3-di(propan-2-yl)piperidine (PubChem CID 58779014) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-methoxy-1,3-di(propan-2-yl)piperidine.
Molecular Properties
| Compound Name | 4-methoxy-1,3-di(propan-2-yl)piperidine |
| PubChem CID | 58779014 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4-methoxy-1,3-di(propan-2-yl)piperidine |
| SMILES | COC1CCN(C(C)C)CC1C(C)C |
| InChI | InChI=1S/C12H25NO/c1-9(2)11-8-13(10(3)4)7-6-12(11)14-5/h9-12H,6-8H2,1-5H3 |
| InChIKey | NOXQUEFUUWIANX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-1,3-di(propan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,3-di(propan-2-yl)piperidine?
The IUPAC name of 4-methoxy-1,3-di(propan-2-yl)piperidine (CID 58779014) is 4-methoxy-1,3-di(propan-2-yl)piperidine.
What is the SMILES notation for 4-methoxy-1,3-di(propan-2-yl)piperidine?
The canonical SMILES for 4-methoxy-1,3-di(propan-2-yl)piperidine is COC1CCN(C(C)C)CC1C(C)C.
What is the InChIKey of 4-methoxy-1,3-di(propan-2-yl)piperidine?
The InChIKey is NOXQUEFUUWIANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-9(2)11-8-13(10(3)4)7-6-12(11)14-5/h9-12H,6-8H2,1-5H3.
What are the key properties of 4-methoxy-1,3-di(propan-2-yl)piperidine?
4-methoxy-1,3-di(propan-2-yl)piperidine has a molecular weight of 199.34 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,3-di(propan-2-yl)piperidine is sourced from PubChem (CID 58779014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).