C21H21ClF4N2O2 — CID 58779111
2-(6-chloro-5-methoxy-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine (PubChem CID 58779111) has the molecular formula C21H21ClF4N2O2 and a molecular weight of 444.86 g/mol. Its IUPAC name is 2-(6-chloro-5-methoxy-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-(6-chloro-5-methoxy-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 58779111 |
| Molecular Formula | C21H21ClF4N2O2 |
| Molecular Weight | 444.86 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-(6-chloro-5-methoxy-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine |
| SMILES | COc1cc2c(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c[nH]c2cc1Cl |
| InChI | InChI=1S/C21H21ClF4N2O2/c1-29-19-8-16-14(11-28-18(16)9-17(19)22)5-6-27-10-13-3-2-4-15(7-13)30-12-21(25,26)20(23)24/h2-4,7-9,11,20,27-28H,5-6,10,12H2,1H3 |
| InChIKey | VBOQJBVRQUSWDB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|