C19H18F4N2O — CID 58779122
2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine (PubChem CID 58779122) has the molecular formula C19H18F4N2O and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 58779122 |
| Molecular Formula | C19H18F4N2O |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]ethanamine |
| SMILES | Fc1ccc2c(CCNCc3cccc(OCC(F)(F)F)c3)c[nH]c2c1 |
| InChI | InChI=1S/C19H18F4N2O/c20-15-4-5-17-14(11-25-18(17)9-15)6-7-24-10-13-2-1-3-16(8-13)26-12-19(21,22)23/h1-5,8-9,11,24-25H,6-7,10,12H2 |
| InChIKey | ZVHSOSDOABZJMA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|