About actinium;3-(dihydroxymethyl)benzenesulfonyl chloride
actinium;3-(dihydroxymethyl)benzenesulfonyl chloride (PubChem CID 58779273) has the molecular formula C7H7Ac2ClO4S
and a molecular weight of 676.65 g/mol. Its IUPAC name is actinium;3-(dihydroxymethyl)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | actinium;3-(dihydroxymethyl)benzenesulfonyl chloride |
| PubChem CID | 58779273 |
| Molecular Formula | C7H7Ac2ClO4S |
| Molecular Weight | 676.65 g/mol |
| Exact Mass | 676.03 |
| IUPAC Name | actinium;3-(dihydroxymethyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccc(C(O)O)c1.[Ac].[Ac] |
| InChI | InChI=1S/C7H7ClO4S.2Ac/c8-13(11,12)6-3-1-2-5(4-6)7(9)10;;/h1-4,7,9-10H;; |
| InChIKey | SRNXGHRORVNYIC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 676.65 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze actinium;3-(dihydroxymethyl)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;3-(dihydroxymethyl)benzenesulfonyl chloride?
The IUPAC name of actinium;3-(dihydroxymethyl)benzenesulfonyl chloride (CID 58779273) is actinium;3-(dihydroxymethyl)benzenesulfonyl chloride.
What is the SMILES notation for actinium;3-(dihydroxymethyl)benzenesulfonyl chloride?
The canonical SMILES for actinium;3-(dihydroxymethyl)benzenesulfonyl chloride is O=S(=O)(Cl)c1cccc(C(O)O)c1.[Ac].[Ac].
What is the InChIKey of actinium;3-(dihydroxymethyl)benzenesulfonyl chloride?
The InChIKey is SRNXGHRORVNYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO4S.2Ac/c8-13(11,12)6-3-1-2-5(4-6)7(9)10;;/h1-4,7,9-10H;;.
What are the key properties of actinium;3-(dihydroxymethyl)benzenesulfonyl chloride?
actinium;3-(dihydroxymethyl)benzenesulfonyl chloride has a molecular weight of 676.65 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;3-(dihydroxymethyl)benzenesulfonyl chloride is sourced from PubChem (CID 58779273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).