C9H9F3O3S2 — CID 58779364
4,5,6,7-tetrahydro-1-benzothiophen-4-yl trifluoromethanesulfonate (PubChem CID 58779364) has the molecular formula C9H9F3O3S2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophen-4-yl trifluoromethanesulfonate.
| Compound Name | 4,5,6,7-tetrahydro-1-benzothiophen-4-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58779364 |
| Molecular Formula | C9H9F3O3S2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophen-4-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1CCCc2sccc21)C(F)(F)F |
| InChI | InChI=1S/C9H9F3O3S2/c10-9(11,12)17(13,14)15-7-2-1-3-8-6(7)4-5-16-8/h4-5,7H,1-3H2 |
| InChIKey | CJZINFRAGCPTBO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|