About 3-butyl-2,3-diethyloxetane
3-butyl-2,3-diethyloxetane (PubChem CID 58779787) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 3-butyl-2,3-diethyloxetane.
Molecular Properties
| Compound Name | 3-butyl-2,3-diethyloxetane |
| PubChem CID | 58779787 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 3-butyl-2,3-diethyloxetane |
| SMILES | CCCCC1(CC)COC1CC |
| InChI | InChI=1S/C11H22O/c1-4-7-8-11(6-3)9-12-10(11)5-2/h10H,4-9H2,1-3H3 |
| InChIKey | VZIJZJGLAJXLRX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-2,3-diethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2,3-diethyloxetane?
The IUPAC name of 3-butyl-2,3-diethyloxetane (CID 58779787) is 3-butyl-2,3-diethyloxetane.
What is the SMILES notation for 3-butyl-2,3-diethyloxetane?
The canonical SMILES for 3-butyl-2,3-diethyloxetane is CCCCC1(CC)COC1CC.
What is the InChIKey of 3-butyl-2,3-diethyloxetane?
The InChIKey is VZIJZJGLAJXLRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-4-7-8-11(6-3)9-12-10(11)5-2/h10H,4-9H2,1-3H3.
What are the key properties of 3-butyl-2,3-diethyloxetane?
3-butyl-2,3-diethyloxetane has a molecular weight of 170.30 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2,3-diethyloxetane is sourced from PubChem (CID 58779787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).