About methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate
methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate (PubChem CID 58780962) has the molecular formula C30H28N2O5
and a molecular weight of 496.56 g/mol. Its IUPAC name is methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate |
| PubChem CID | 58780962 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(COCc3ccccc3)cc(COCc3ccccc3)c2)nc1 |
| InChI | InChI=1S/C30H28N2O5/c1-35-30(34)26-12-13-28(31-17-26)32-29(33)27-15-24(20-36-18-22-8-4-2-5-9-22)14-25(16-27)21-37-19-23-10-6-3-7-11-23/h2-17H,18-21H2,1H3,(H,31,32,33) |
| InChIKey | OEVHQYTXOZWGFI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate (CID 58780962) is methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate is COC(=O)c1ccc(NC(=O)c2cc(COCc3ccccc3)cc(COCc3ccccc3)c2)nc1.
What is the InChIKey of methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate?
The InChIKey is OEVHQYTXOZWGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28N2O5/c1-35-30(34)26-12-13-28(31-17-26)32-29(33)27-15-24(20-36-18-22-8-4-2-5-9-22)14-25(16-27)21-37-19-23-10-6-3-7-11-23/h2-17H,18-21H2,1H3,(H,31,32,33).
What are the key properties of methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate?
methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate has a molecular weight of 496.56 g/mol, XLogP of 5.55, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[3,5-bis(phenylmethoxymethyl)benzoyl]amino]pyridine-3-carboxylate is sourced from PubChem (CID 58780962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).