C27H42N2O6 — CID 58780981
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(1S,3S)-3-aminocyclopentyl]oxycarbonylcarbamate (PubChem CID 58780981) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(1S,3S)-3-aminocyclopentyl]oxycarbonylcarbamate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(1S,3S)-3-aminocyclopentyl]oxycarbonylcarbamate |
|---|---|
| PubChem CID | 58780981 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(1S,3S)-3-aminocyclopentyl]oxycarbonylcarbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)O[C@H]2CC[C@H](N)C2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H42N2O6/c1-6-25(4)14-20(35-24(33)29-23(32)34-18-8-7-17(28)13-18)26(5)15(2)9-11-27(16(3)22(25)31)12-10-19(30)21(26)27/h6,15-18,20-22,31H,1,7-14,28H2,2-5H3,(H,29,32,33)/t15-,16+,17+,18+,20-,21+,22+,25-,26+,27+/m1/s1 |
| InChIKey | WNKSWNGFCDEECH-OTOYFCPJSA-N |
| XLogP | 4.09 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|