C19H19F2IN4O3 — CID 58781090
N-(3,4-dihydroxybutyl)-7-fluoro-6-(2-fluoro-4-iodoanilino)-3-methylbenzimidazole-5-carboxamide (PubChem CID 58781090) has the molecular formula C19H19F2IN4O3 and a molecular weight of 516.29 g/mol. Its IUPAC name is N-(3,4-dihydroxybutyl)-7-fluoro-6-(2-fluoro-4-iodoanilino)-3-methylbenzimidazole-5-carboxamide.
| Compound Name | N-(3,4-dihydroxybutyl)-7-fluoro-6-(2-fluoro-4-iodoanilino)-3-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58781090 |
| Molecular Formula | C19H19F2IN4O3 |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | N-(3,4-dihydroxybutyl)-7-fluoro-6-(2-fluoro-4-iodoanilino)-3-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1cnc2c(F)c(Nc3ccc(I)cc3F)c(C(=O)NCCC(O)CO)cc21 |
| InChI | InChI=1S/C19H19F2IN4O3/c1-26-9-24-18-15(26)7-12(19(29)23-5-4-11(28)8-27)17(16(18)21)25-14-3-2-10(22)6-13(14)20/h2-3,6-7,9,11,25,27-28H,4-5,8H2,1H3,(H,23,29) |
| InChIKey | SEKQKPOGGKULAQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|