C56H24N2O8 — CID 58781181
36-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexatriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35-octadecaynyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 58781181) has the molecular formula C56H24N2O8 and a molecular weight of 852.81 g/mol. Its IUPAC name is 36-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexatriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35-octadecaynyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | 36-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexatriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35-octadecaynyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 58781181 |
| Molecular Formula | C56H24N2O8 |
| Molecular Weight | 852.81 g/mol |
| Exact Mass | 852.15 |
| IUPAC Name | 36-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexatriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35-octadecaynyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#COC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C56H24N2O8/c59-51-43-44-52(60)57(51)47-37-33-35-41-55(63)65-49-39-31-29-27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-40-50-66-56(64)42-36-34-38-48-58-53(61)45-46-54(58)62/h43-46H,33-38,41-42,47-48H2 |
| InChIKey | NTJIUQCWODYDDK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.81 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|