About bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese
bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese (PubChem CID 58781426) has the molecular formula C38H40MnN8O4
and a molecular weight of 727.73 g/mol. Its IUPAC name is bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese.
Molecular Properties
| Compound Name | bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese |
| PubChem CID | 58781426 |
| Molecular Formula | C38H40MnN8O4 |
| Molecular Weight | 727.73 g/mol |
| Exact Mass | 727.26 |
| IUPAC Name | bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese |
| SMILES | OCCN(CCO)c1cc(-c2ccccn2)nc(-c2ccccn2)c1.OCCN(CCO)c1cc(-c2ccccn2)nc(-c2ccccn2)c1.[Mn] |
| InChI | InChI=1S/2C19H20N4O2.Mn/c2*24-11-9-23(10-12-25)15-13-18(16-5-1-3-7-20-16)22-19(14-15)17-6-2-4-8-21-17;/h2*1-8,13-14,24-25H,9-12H2; |
| InChIKey | SZKLZUJPJRSHLO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 727.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese?
The IUPAC name of bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese (CID 58781426) is bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese.
What is the SMILES notation for bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese?
The canonical SMILES for bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese is OCCN(CCO)c1cc(-c2ccccn2)nc(-c2ccccn2)c1.OCCN(CCO)c1cc(-c2ccccn2)nc(-c2ccccn2)c1.[Mn].
What is the InChIKey of bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese?
The InChIKey is SZKLZUJPJRSHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H20N4O2.Mn/c2*24-11-9-23(10-12-25)15-13-18(16-5-1-3-7-20-16)22-19(14-15)17-6-2-4-8-21-17;/h2*1-8,13-14,24-25H,9-12H2;.
What are the key properties of bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese?
bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese has a molecular weight of 727.73 g/mol, XLogP of 3.99, 14 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(2,6-dipyridin-2-yl-4-pyridinyl)-(2-hydroxyethyl)amino]ethanol);manganese is sourced from PubChem (CID 58781426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).