About 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol
2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 58781431) has the molecular formula C23H28N4O4
and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 58781431 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCOc1ccnc(-c2cc(N(CCO)CCO)cc(-c3cc(OCC)ccn3)n2)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-3-30-18-5-7-24-20(15-18)22-13-17(27(9-11-28)10-12-29)14-23(26-22)21-16-19(31-4-2)6-8-25-21/h5-8,13-16,28-29H,3-4,9-12H2,1-2H3 |
| InChIKey | XXJNVQJEOKULKV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol (CID 58781431) is 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol is CCOc1ccnc(-c2cc(N(CCO)CCO)cc(-c3cc(OCC)ccn3)n2)c1.
What is the InChIKey of 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol?
The InChIKey is XXJNVQJEOKULKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O4/c1-3-30-18-5-7-24-20(15-18)22-13-17(27(9-11-28)10-12-29)14-23(26-22)21-16-19(31-4-2)6-8-25-21/h5-8,13-16,28-29H,3-4,9-12H2,1-2H3.
What are the key properties of 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol?
2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol has a molecular weight of 424.50 g/mol, XLogP of 2.79, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-bis(4-ethoxy-2-pyridinyl)-4-pyridinyl]-(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 58781431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).