About 2-chloro-N-ethylaniline
2-chloro-N-ethylaniline (PubChem CID 587815) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 2-chloro-N-ethylaniline.
Molecular Properties
| Compound Name | 2-chloro-N-ethylaniline |
| PubChem CID | 587815 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 2-chloro-N-ethylaniline |
| SMILES | CCNc1ccccc1Cl |
| InChI | InChI=1S/C8H10ClN/c1-2-10-8-6-4-3-5-7(8)9/h3-6,10H,2H2,1H3 |
| InChIKey | OMQUELHMHMORKS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-ethylaniline?
The IUPAC name of 2-chloro-N-ethylaniline (CID 587815) is 2-chloro-N-ethylaniline.
What is the SMILES notation for 2-chloro-N-ethylaniline?
The canonical SMILES for 2-chloro-N-ethylaniline is CCNc1ccccc1Cl.
What is the InChIKey of 2-chloro-N-ethylaniline?
The InChIKey is OMQUELHMHMORKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN/c1-2-10-8-6-4-3-5-7(8)9/h3-6,10H,2H2,1H3.
What are the key properties of 2-chloro-N-ethylaniline?
2-chloro-N-ethylaniline has a molecular weight of 155.63 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-ethylaniline is sourced from PubChem (CID 587815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).