C11H15N3O2S2 — CID 58781884
[(2S)-1-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridin-2-yl]methyl carbamate (PubChem CID 58781884) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is [(2S)-1-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridin-2-yl]methyl carbamate.
| Compound Name | [(2S)-1-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridin-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 58781884 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [(2S)-1-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridin-2-yl]methyl carbamate |
| SMILES | CN1CC=C(c2csc(=S)[nH]2)C[C@H]1COC(N)=O |
| InChI | InChI=1S/C11H15N3O2S2/c1-14-3-2-7(9-6-18-11(17)13-9)4-8(14)5-16-10(12)15/h2,6,8H,3-5H2,1H3,(H2,12,15)(H,13,17)/t8-/m0/s1 |
| InChIKey | BVRFBCGXLVDKMJ-QMMMGPOBSA-N |
| XLogP | 1.99 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|