About ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate
ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate (PubChem CID 58782216) has the molecular formula C12H22O4Si
and a molecular weight of 258.39 g/mol. Its IUPAC name is ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate.
Molecular Properties
| Compound Name | ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate |
| PubChem CID | 58782216 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate |
| SMILES | CCOC(=O)C[C@H](O)C[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H22O4Si/c1-5-16-12(15)9-11(14)8-10(13)6-7-17(2,3)4/h10-11,13-14H,5,8-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | PAPLDDVAHOTODD-GHMZBOCLSA-N |
| XLogP | 0.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate?
The IUPAC name of ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate (CID 58782216) is ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate.
What is the SMILES notation for ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate?
The canonical SMILES for ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate is CCOC(=O)C[C@H](O)C[C@H](O)C#C[Si](C)(C)C.
What is the InChIKey of ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate?
The InChIKey is PAPLDDVAHOTODD-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H22O4Si/c1-5-16-12(15)9-11(14)8-10(13)6-7-17(2,3)4/h10-11,13-14H,5,8-9H2,1-4H3/t10-,11-/m1/s1.
What are the key properties of ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate?
ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate has a molecular weight of 258.39 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R,5S)-3,5-dihydroxy-7-trimethylsilylhept-6-ynoate is sourced from PubChem (CID 58782216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).