About 2-methoxypropane;rutherfordium
2-methoxypropane;rutherfordium (PubChem CID 58782378) has the molecular formula C4H9ORf-
and a molecular weight of 340.12 g/mol. Its IUPAC name is 2-methoxypropane;rutherfordium.
Molecular Properties
| Compound Name | 2-methoxypropane;rutherfordium |
| PubChem CID | 58782378 |
| Molecular Formula | C4H9ORf- |
| Molecular Weight | 340.12 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-methoxypropane;rutherfordium |
| SMILES | CO[C-](C)C.[Rf] |
| InChI | InChI=1S/C4H9O.Rf/c1-4(2)5-3;/h1-3H3;/q-1; |
| InChIKey | KVKOEQXVFHLBFX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxypropane;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropane;rutherfordium?
The IUPAC name of 2-methoxypropane;rutherfordium (CID 58782378) is 2-methoxypropane;rutherfordium.
What is the SMILES notation for 2-methoxypropane;rutherfordium?
The canonical SMILES for 2-methoxypropane;rutherfordium is CO[C-](C)C.[Rf].
What is the InChIKey of 2-methoxypropane;rutherfordium?
The InChIKey is KVKOEQXVFHLBFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.Rf/c1-4(2)5-3;/h1-3H3;/q-1;.
What are the key properties of 2-methoxypropane;rutherfordium?
2-methoxypropane;rutherfordium has a molecular weight of 340.12 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropane;rutherfordium is sourced from PubChem (CID 58782378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).